Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
| Name Note | Magnet Alloy Additive |
|---|---|
| MDL Number | MFCD02091729 |
| Color | Gray-Silver |
| Solubility Information | Insoluble in water. |
| Physical Form | Broken Lump |
| Chemical Name or Material | Neodymium Boron Iron |
| Synonym | Magnet Alloy Additive |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Nd:B:Fe; 15:8:77 atomic% |
| Appearance | Silver gray broken lump |
| Odor | Odorless |
Chromyl chloride, 99.99% (metals basis)
CAS: 14977-61-8 Molecular Formula: Cl2CrH4O2 Molecular Weight (g/mol): 158.926 MDL Number: MFCD00010951 InChI Key: HOCPFYCTFLRIAK-UHFFFAOYSA-L Synonym: chromyl chloride PubChem CID: 101943071 IUPAC Name: chromium(2+);dichloride;dihydrate SMILES: O.O.[Cl-].[Cl-].[Cr+2]
| PubChem CID | 101943071 |
|---|---|
| CAS | 14977-61-8 |
| Molecular Weight (g/mol) | 158.926 |
| MDL Number | MFCD00010951 |
| SMILES | O.O.[Cl-].[Cl-].[Cr+2] |
| Synonym | chromyl chloride |
| IUPAC Name | chromium(2+);dichloride;dihydrate |
| InChI Key | HOCPFYCTFLRIAK-UHFFFAOYSA-L |
| Molecular Formula | Cl2CrH4O2 |
Ammonium Acetate Anhydrous, ACS Reagent Grade, MP Biomedicals™
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Methyldiphenylsilane, 97%
CAS: 776-76-1 Molecular Formula: C13H13Si Molecular Weight (g/mol): 197.332 MDL Number: MFCD00008255 InChI Key: OKHRRIGNGQFVEE-UHFFFAOYSA-N Synonym: methyldiphenylsilane,diphenylmethylsilane,silane, methyldiphenyl,benzene, 1,1'-methylsilylene bis,methyldiphenylsilyl,methyl diphenyl silicon,methyl-di phenyl silicon,silane, methyldiphenyl-, PubChem CID: 6327660 IUPAC Name: methyl(diphenyl)silicon SMILES: C[Si](C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 6327660 |
|---|---|
| CAS | 776-76-1 |
| Molecular Weight (g/mol) | 197.332 |
| MDL Number | MFCD00008255 |
| SMILES | C[Si](C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | methyldiphenylsilane,diphenylmethylsilane,silane, methyldiphenyl,benzene, 1,1'-methylsilylene bis,methyldiphenylsilyl,methyl diphenyl silicon,methyl-di phenyl silicon,silane, methyldiphenyl-, |
| IUPAC Name | methyl(diphenyl)silicon |
| InChI Key | OKHRRIGNGQFVEE-UHFFFAOYSA-N |
| Molecular Formula | C13H13Si |
Phenyltrimethylsilane, 98%
CAS: 768-32-1 Molecular Formula: C9H14Si Molecular Weight (g/mol): 150.30 MDL Number: MFCD00008271 InChI Key: KXFSUVJPEQYUGN-UHFFFAOYSA-N Synonym: phenyltrimethylsilane,trimethyl phenyl silane,silane, trimethylphenyl,trimethylsilyl benzene,unii-px1sg1q5yp,benzene, trimethylsilyl,silane, trimethyl phenyl,px1sg1q5yp,phenyl trimethylsilane,trimethyl-phenylsilane PubChem CID: 69849 IUPAC Name: trimethyl(phenyl)silane SMILES: C[Si](C)(C)C1=CC=CC=C1
| PubChem CID | 69849 |
|---|---|
| CAS | 768-32-1 |
| Molecular Weight (g/mol) | 150.30 |
| MDL Number | MFCD00008271 |
| SMILES | C[Si](C)(C)C1=CC=CC=C1 |
| Synonym | phenyltrimethylsilane,trimethyl phenyl silane,silane, trimethylphenyl,trimethylsilyl benzene,unii-px1sg1q5yp,benzene, trimethylsilyl,silane, trimethyl phenyl,px1sg1q5yp,phenyl trimethylsilane,trimethyl-phenylsilane |
| IUPAC Name | trimethyl(phenyl)silane |
| InChI Key | KXFSUVJPEQYUGN-UHFFFAOYSA-N |
| Molecular Formula | C9H14Si |
2-(Chloromethoxy)ethyltrimethylsilane, tech. 90%, stab. with 0.1% N,N-Diisopropylethylamine
CAS: 76513-69-4 Molecular Formula: C6H15ClOSi Molecular Weight (g/mol): 166.72 MDL Number: MFCD00009919 InChI Key: BPXKZEMBEZGUAH-UHFFFAOYSA-N Synonym: 2-trimethylsilyl ethoxymethyl chloride,2-chloromethoxy ethyl trimethylsilane,sem-chloride,2-trimethylsilyl ethoxymethylchloride,sem-cl,2-chloromethyl 2-trimethylsilyl ethyl ether,semcl,2-chloromethoxy ethyl-trimethylsilane,2-trimethysilyl-ethoxymethyl chloride PubChem CID: 2724271 IUPAC Name: 2-(chloromethoxy)ethyl-trimethylsilane SMILES: C[Si](C)(C)CCOCCl
| PubChem CID | 2724271 |
|---|---|
| CAS | 76513-69-4 |
| Molecular Weight (g/mol) | 166.72 |
| MDL Number | MFCD00009919 |
| SMILES | C[Si](C)(C)CCOCCl |
| Synonym | 2-trimethylsilyl ethoxymethyl chloride,2-chloromethoxy ethyl trimethylsilane,sem-chloride,2-trimethylsilyl ethoxymethylchloride,sem-cl,2-chloromethyl 2-trimethylsilyl ethyl ether,semcl,2-chloromethoxy ethyl-trimethylsilane,2-trimethysilyl-ethoxymethyl chloride |
| IUPAC Name | 2-(chloromethoxy)ethyl-trimethylsilane |
| InChI Key | BPXKZEMBEZGUAH-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClOSi |
Boron nitride, 99.5% (metals basis), Thermo Scientific™
CAS: 10043-11-5 Molecular Formula: BN Molecular Weight (g/mol): 24.82 MDL Number: MFCD00011317 InChI Key: LNLSXDSWJBUPHM-UHFFFAOYSA-N Synonym: boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r PubChem CID: 66227 ChEBI: CHEBI:50883 IUPAC Name: boranylidyneamine SMILES: B=N
| PubChem CID | 66227 |
|---|---|
| CAS | 10043-11-5 |
| Molecular Weight (g/mol) | 24.82 |
| ChEBI | CHEBI:50883 |
| MDL Number | MFCD00011317 |
| SMILES | B=N |
| Synonym | boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r |
| IUPAC Name | boranylidyneamine |
| InChI Key | LNLSXDSWJBUPHM-UHFFFAOYSA-N |
| Molecular Formula | BN |
(2-Cyanoethyl)triethoxysilane, 97%
CAS: 919-31-3 Molecular Formula: C9H19NO3Si Molecular Weight (g/mol): 217.34 MDL Number: MFCD00019851 InChI Key: GBQYMXVQHATSCC-UHFFFAOYSA-N Synonym: 3-triethoxysilyl propionitrile,2-cyanoethyl triethoxysilane,2-cyanoethyltriethoxysilane,propanenitrile, 3-triethoxysilyl,beta-cyanoethyltriethoxysilane,3-triethoxysilyl propanenitrile,propionitrile, 3-triethoxysilyl,silane, 2-cyanoethyl triethoxy,triethoxy-2-kyanethylsilan,unii-0i8r6d195f PubChem CID: 13522 IUPAC Name: 3-triethoxysilylpropanenitrile SMILES: CCO[Si](CCC#N)(OCC)OCC
| PubChem CID | 13522 |
|---|---|
| CAS | 919-31-3 |
| Molecular Weight (g/mol) | 217.34 |
| MDL Number | MFCD00019851 |
| SMILES | CCO[Si](CCC#N)(OCC)OCC |
| Synonym | 3-triethoxysilyl propionitrile,2-cyanoethyl triethoxysilane,2-cyanoethyltriethoxysilane,propanenitrile, 3-triethoxysilyl,beta-cyanoethyltriethoxysilane,3-triethoxysilyl propanenitrile,propionitrile, 3-triethoxysilyl,silane, 2-cyanoethyl triethoxy,triethoxy-2-kyanethylsilan,unii-0i8r6d195f |
| IUPAC Name | 3-triethoxysilylpropanenitrile |
| InChI Key | GBQYMXVQHATSCC-UHFFFAOYSA-N |
| Molecular Formula | C9H19NO3Si |
Methyltriethoxysilane, 98%
CAS: 2031-67-6 Molecular Formula: C7H18O3Si Molecular Weight (g/mol): 178.30 MDL Number: MFCD00009066 InChI Key: CPUDPFPXCZDNGI-UHFFFAOYSA-N Synonym: methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes PubChem CID: 16241 IUPAC Name: triethoxy(methyl)silane SMILES: CCO[Si](C)(OCC)OCC
| PubChem CID | 16241 |
|---|---|
| CAS | 2031-67-6 |
| Molecular Weight (g/mol) | 178.30 |
| MDL Number | MFCD00009066 |
| SMILES | CCO[Si](C)(OCC)OCC |
| Synonym | methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes |
| IUPAC Name | triethoxy(methyl)silane |
| InChI Key | CPUDPFPXCZDNGI-UHFFFAOYSA-N |
| Molecular Formula | C7H18O3Si |
N-Methyl-N-trimethylsilylacetamide, 98%
CAS: 7449-74-3 Molecular Formula: C6H15NOSi Molecular Weight (g/mol): 145.277 MDL Number: MFCD00040758 InChI Key: QHUOBLDKFGCVCG-UHFFFAOYSA-N Synonym: n-methyl-n-trimethylsilyl acetamide,acetamide, n-methyl-n-trimethylsilyl,n-trimethylsilyl-n-methylacetamide,n-methyl-n-tms-acetamide,acmc-1bei6,qhuobldkfgcvcg-uhfffaoysa,n-methylacetamide, tms derivative,n-methyl-n-trimethylsilylacetamide, for gc derivatization gc PubChem CID: 81953 IUPAC Name: N-methyl-N-trimethylsilylacetamide SMILES: CC(=O)N(C)[Si](C)(C)C
| PubChem CID | 81953 |
|---|---|
| CAS | 7449-74-3 |
| Molecular Weight (g/mol) | 145.277 |
| MDL Number | MFCD00040758 |
| SMILES | CC(=O)N(C)[Si](C)(C)C |
| Synonym | n-methyl-n-trimethylsilyl acetamide,acetamide, n-methyl-n-trimethylsilyl,n-trimethylsilyl-n-methylacetamide,n-methyl-n-tms-acetamide,acmc-1bei6,qhuobldkfgcvcg-uhfffaoysa,n-methylacetamide, tms derivative,n-methyl-n-trimethylsilylacetamide, for gc derivatization gc |
| IUPAC Name | N-methyl-N-trimethylsilylacetamide |
| InChI Key | QHUOBLDKFGCVCG-UHFFFAOYSA-N |
| Molecular Formula | C6H15NOSi |
Manganese Dioxide, MP Biomedicals
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Ammonium sulfite monohydrate, 92% min
CAS: 7783-11-1 Molecular Formula: H10N2O4S Molecular Weight (g/mol): 134.15 MDL Number: MFCD00066094 InChI Key: ASPXBYAQZVXSNS-UHFFFAOYSA-N PubChem CID: 21701053 IUPAC Name: diazanium;sulfite;hydrate SMILES: [NH4+].[NH4+].O.[O-]S(=O)[O-]
| PubChem CID | 21701053 |
|---|---|
| CAS | 7783-11-1 |
| Molecular Weight (g/mol) | 134.15 |
| MDL Number | MFCD00066094 |
| SMILES | [NH4+].[NH4+].O.[O-]S(=O)[O-] |
| IUPAC Name | diazanium;sulfite;hydrate |
| InChI Key | ASPXBYAQZVXSNS-UHFFFAOYSA-N |
| Molecular Formula | H10N2O4S |
Manganese(IV) oxide, 99.99+%, (trace metal basis)
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Dichlorophenylsilane, 96%
CAS: 1631-84-1 Molecular Formula: C6H5Cl2Si Molecular Weight (g/mol): 176.09 MDL Number: MFCD00039296 InChI Key: XNAFLNBULDHNJS-UHFFFAOYSA-N Synonym: phenyldichlorosilane,dichlorophenylsilane,dichloro phenyl silane,dichloro phenyl silicon,benzene, dichlorosilyl,phenyl dichlorosilane,phenyl hydrogen dichlorosilane,phenyl-dichlorosilane,phenyldichloro silane,dichloro phenyl silyl PubChem CID: 6327324 SMILES: Cl[Si](Cl)C1=CC=CC=C1
| PubChem CID | 6327324 |
|---|---|
| CAS | 1631-84-1 |
| Molecular Weight (g/mol) | 176.09 |
| MDL Number | MFCD00039296 |
| SMILES | Cl[Si](Cl)C1=CC=CC=C1 |
| Synonym | phenyldichlorosilane,dichlorophenylsilane,dichloro phenyl silane,dichloro phenyl silicon,benzene, dichlorosilyl,phenyl dichlorosilane,phenyl hydrogen dichlorosilane,phenyl-dichlorosilane,phenyldichloro silane,dichloro phenyl silyl |
| InChI Key | XNAFLNBULDHNJS-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2Si |
Zinc wire, 1.0mm (0.04in) dia, 99.95% (metals basis)
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |