Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Triphenylvinylsilane, 98%
CAS: 18666-68-7 Molecular Formula: C20H18Si Molecular Weight (g/mol): 286.449 MDL Number: MFCD00051542 InChI Key: OVOIHGSHJGMSMZ-UHFFFAOYSA-N Synonym: triphenylvinylsilane,silane, ethenyltriphenyl,triphenyl vinyl silane,silane, triphenylvinyl,vinyltriphenylsilane,benzene, 1,1',1-ethenylsilylidyne tris,ethenyltriphenylsilan,vinyltriphenyl silane,vinyl triphenyl silane,ethenyl triphenyl silane PubChem CID: 87747 IUPAC Name: ethenyl(triphenyl)silane SMILES: C=C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 87747 |
|---|---|
| CAS | 18666-68-7 |
| Molecular Weight (g/mol) | 286.449 |
| MDL Number | MFCD00051542 |
| SMILES | C=C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | triphenylvinylsilane,silane, ethenyltriphenyl,triphenyl vinyl silane,silane, triphenylvinyl,vinyltriphenylsilane,benzene, 1,1',1-ethenylsilylidyne tris,ethenyltriphenylsilan,vinyltriphenyl silane,vinyl triphenyl silane,ethenyl triphenyl silane |
| IUPAC Name | ethenyl(triphenyl)silane |
| InChI Key | OVOIHGSHJGMSMZ-UHFFFAOYSA-N |
| Molecular Formula | C20H18Si |
1,4-Bis(trimethylsilyl)tetrafluorobenzene, 98%
CAS: 16956-91-5 Molecular Formula: C12H18F4Si2 Molecular Weight (g/mol): 294.44 MDL Number: MFCD00093109 InChI Key: RIGHSQASRZUCPK-UHFFFAOYSA-N Synonym: 1,4-bis trimethylsilyl tetrafluorobenzene,trimethyl 2,3,5,6-tetrafluoro-4-trimethylsilyl phenyl silane,acmc-20ap2x,1,4-bis-trimethylsilyl tetrafluorobenzene,perfluoro-1,4-phenylene bis trimethylsilane,tetrafluoro-1,4-phenylenebis trimethylsilane,1,2,4,5-tetrafluoro-3,6-bis trimethylsilyl-benzene,benzene,1,2,4,5-tetrafluoro-3,6-bis trimethylsilyl,trimethyl-2,3,5,6-tetrafluoro-4-trimethylsilylphenyl silane PubChem CID: 2769673 IUPAC Name: trimethyl-(2,3,5,6-tetrafluoro-4-trimethylsilylphenyl)silane SMILES: C[Si](C)(C)C1=C(C(=C(C(=C1F)F)[Si](C)(C)C)F)F
| PubChem CID | 2769673 |
|---|---|
| CAS | 16956-91-5 |
| Molecular Weight (g/mol) | 294.44 |
| MDL Number | MFCD00093109 |
| SMILES | C[Si](C)(C)C1=C(C(=C(C(=C1F)F)[Si](C)(C)C)F)F |
| Synonym | 1,4-bis trimethylsilyl tetrafluorobenzene,trimethyl 2,3,5,6-tetrafluoro-4-trimethylsilyl phenyl silane,acmc-20ap2x,1,4-bis-trimethylsilyl tetrafluorobenzene,perfluoro-1,4-phenylene bis trimethylsilane,tetrafluoro-1,4-phenylenebis trimethylsilane,1,2,4,5-tetrafluoro-3,6-bis trimethylsilyl-benzene,benzene,1,2,4,5-tetrafluoro-3,6-bis trimethylsilyl,trimethyl-2,3,5,6-tetrafluoro-4-trimethylsilylphenyl silane |
| IUPAC Name | trimethyl-(2,3,5,6-tetrafluoro-4-trimethylsilylphenyl)silane |
| InChI Key | RIGHSQASRZUCPK-UHFFFAOYSA-N |
| Molecular Formula | C12H18F4Si2 |
9-(Trimethylsilyl)fluorene, 99%
CAS: 7385-10-6 Molecular Formula: C16H18Si Molecular Weight (g/mol): 238.41 MDL Number: MFCD00092570 InChI Key: YFPRGLHBYSNHMW-UHFFFAOYSA-N Synonym: 9-trimethylsilyl fluorene,9h-fluoren-9-yl trimethyl silane,9-trimethylsilylfluorene,silane, 9h-fluoren-9-yltrimethyl,9-fluorenyl trimethylsilane,9h-fluoren-9-yl trimethyl silane # PubChem CID: 553570 IUPAC Name: 9H-fluoren-9-yl(trimethyl)silane SMILES: C[Si](C)(C)C1C2=CC=CC=C2C3=CC=CC=C13
| PubChem CID | 553570 |
|---|---|
| CAS | 7385-10-6 |
| Molecular Weight (g/mol) | 238.41 |
| MDL Number | MFCD00092570 |
| SMILES | C[Si](C)(C)C1C2=CC=CC=C2C3=CC=CC=C13 |
| Synonym | 9-trimethylsilyl fluorene,9h-fluoren-9-yl trimethyl silane,9-trimethylsilylfluorene,silane, 9h-fluoren-9-yltrimethyl,9-fluorenyl trimethylsilane,9h-fluoren-9-yl trimethyl silane # |
| IUPAC Name | 9H-fluoren-9-yl(trimethyl)silane |
| InChI Key | YFPRGLHBYSNHMW-UHFFFAOYSA-N |
| Molecular Formula | C16H18Si |
Silicon powder, crystalline, -100 mesh, 99.9% (metals basis)
CAS: 7440-21-3 Molecular Formula: Si Molecular Weight (g/mol): 28.09 MDL Number: MFCD00085311 InChI Key: XUIMIQQOPSSXEZ-UHFFFAOYSA-N Synonym: metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 PubChem CID: 5461123 ChEBI: CHEBI:27573 IUPAC Name: silicon SMILES: [Si]
| PubChem CID | 5461123 |
|---|---|
| CAS | 7440-21-3 |
| Molecular Weight (g/mol) | 28.09 |
| ChEBI | CHEBI:27573 |
| MDL Number | MFCD00085311 |
| SMILES | [Si] |
| Synonym | metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 |
| IUPAC Name | silicon |
| InChI Key | XUIMIQQOPSSXEZ-UHFFFAOYSA-N |
| Molecular Formula | Si |
Platinum powder, amorphous, APS 2.0-8.0 micron, 99.9% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Copper foil, 1.27mm (0.05in) thick, 99.9% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
(Aminoethylaminomethyl)phenethyltrimethoxysilane, mixture of m and p isomers
CAS: 74113-77-2 Molecular Formula: H2NC2H4NHCH2C6H4C2H4Si(OCH3)3 MDL Number: MFCD00054775 Synonym: aminoethy-laminomethyl phenethyl-trimethoxysilane,4-2-aminoethylaminomethyl phenethyltrimethoxysilane,n1-4-2-trimethoxysilyl ethyl benzyl ethane-1,2-diamine,n'-4-2-trimethoxysilylethyl phenyl methyl ethane-1,2-diamine,2-aminoethyl 4-2-trimethoxysilyl ethyl phenyl methyl amine
| CAS | 74113-77-2 |
|---|---|
| MDL Number | MFCD00054775 |
| Synonym | aminoethy-laminomethyl phenethyl-trimethoxysilane,4-2-aminoethylaminomethyl phenethyltrimethoxysilane,n1-4-2-trimethoxysilyl ethyl benzyl ethane-1,2-diamine,n'-4-2-trimethoxysilylethyl phenyl methyl ethane-1,2-diamine,2-aminoethyl 4-2-trimethoxysilyl ethyl phenyl methyl amine |
| Molecular Formula | H2NC2H4NHCH2C6H4C2H4Si(OCH3)3 |
Bronze Gauze, Alloy 220, 40 mesh woven from 0.25mm (0.01 in.) in dia. wire, Thermo Scientific™
Typical composition of alloy: Cu 89.0-91.0%, Fe 0.05% max, Pb 0.5% max Zn remainder
| Form | Gauze |
|---|---|
| MDL Number | MFCD00198187 |
| Chemical Name or Material | Bronze |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Appearance | Bronze colored gauze |
| Mesh Size | 220,40 Mesh |
Chlorotriethylsilane, 98+%
CAS: 994-30-9 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.72 MDL Number: MFCD00000507 InChI Key: DCFKHNIGBAHNSS-UHFFFAOYSA-N Synonym: triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl PubChem CID: 13819 IUPAC Name: chloro(triethyl)silane SMILES: CC[Si](Cl)(CC)CC
| PubChem CID | 13819 |
|---|---|
| CAS | 994-30-9 |
| Molecular Weight (g/mol) | 150.72 |
| MDL Number | MFCD00000507 |
| SMILES | CC[Si](Cl)(CC)CC |
| Synonym | triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl |
| IUPAC Name | chloro(triethyl)silane |
| InChI Key | DCFKHNIGBAHNSS-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Chlorotriisopropylsilane, 97+%
CAS: 13154-24-0 Molecular Formula: C9H21ClSi Molecular Weight (g/mol): 192.80 MDL Number: MFCD00009656 InChI Key: KQIADDMXRMTWHZ-UHFFFAOYSA-N Synonym: triisopropylsilyl chloride,chlorotriisopropylsilane,triisopropylchlorosilane,chlorotris propan-2-yl silane,chloro triisopropyl silane,silane, chlorotris 1-methylethyl,tipscl,triisopropylsilylchloride,triisopropyl chlorosilane,triisopropylchlorosilane, redistilled PubChem CID: 139400 IUPAC Name: chloro-tri(propan-2-yl)silane SMILES: CC(C)[Si](Cl)(C(C)C)C(C)C
| PubChem CID | 139400 |
|---|---|
| CAS | 13154-24-0 |
| Molecular Weight (g/mol) | 192.80 |
| MDL Number | MFCD00009656 |
| SMILES | CC(C)[Si](Cl)(C(C)C)C(C)C |
| Synonym | triisopropylsilyl chloride,chlorotriisopropylsilane,triisopropylchlorosilane,chlorotris propan-2-yl silane,chloro triisopropyl silane,silane, chlorotris 1-methylethyl,tipscl,triisopropylsilylchloride,triisopropyl chlorosilane,triisopropylchlorosilane, redistilled |
| IUPAC Name | chloro-tri(propan-2-yl)silane |
| InChI Key | KQIADDMXRMTWHZ-UHFFFAOYSA-N |
| Molecular Formula | C9H21ClSi |
N-(Trimethylsilyl)diethylamine, 97%
CAS: 996-50-9 Molecular Formula: C7H19NSi Molecular Weight (g/mol): 145.32 MDL Number: MFCD00009040 InChI Key: JOOMLFKONHCLCJ-UHFFFAOYSA-N Synonym: n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine PubChem CID: 70454 ChEBI: CHEBI:85070 IUPAC Name: N-ethyl-N-trimethylsilylethanamine SMILES: CCN(CC)[Si](C)(C)C
| PubChem CID | 70454 |
|---|---|
| CAS | 996-50-9 |
| Molecular Weight (g/mol) | 145.32 |
| ChEBI | CHEBI:85070 |
| MDL Number | MFCD00009040 |
| SMILES | CCN(CC)[Si](C)(C)C |
| Synonym | n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine |
| IUPAC Name | N-ethyl-N-trimethylsilylethanamine |
| InChI Key | JOOMLFKONHCLCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H19NSi |
Bromotrimethylsilane, 97%, stab. with copper powder or silver wire
CAS: 2857-97-8 Molecular Formula: C3H9BrSi Molecular Weight (g/mol): 153.094 MDL Number: MFCD00000048 InChI Key: IYYIVELXUANFED-UHFFFAOYSA-N Synonym: trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide PubChem CID: 76113 IUPAC Name: bromo(trimethyl)silane SMILES: C[Si](C)(C)Br
| PubChem CID | 76113 |
|---|---|
| CAS | 2857-97-8 |
| Molecular Weight (g/mol) | 153.094 |
| MDL Number | MFCD00000048 |
| SMILES | C[Si](C)(C)Br |
| Synonym | trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide |
| IUPAC Name | bromo(trimethyl)silane |
| InChI Key | IYYIVELXUANFED-UHFFFAOYSA-N |
| Molecular Formula | C3H9BrSi |
Bis(trimethylsilyl)methane, 98%
CAS: 2117-28-4 Molecular Formula: C7H20Si2 Molecular Weight (g/mol): 160.41 MDL Number: MFCD00008275 InChI Key: GYIODRUWWNNGPI-UHFFFAOYSA-N Synonym: bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl PubChem CID: 75029 IUPAC Name: trimethyl(trimethylsilylmethyl)silane SMILES: C[Si](C)(C)C[Si](C)(C)C
| PubChem CID | 75029 |
|---|---|
| CAS | 2117-28-4 |
| Molecular Weight (g/mol) | 160.41 |
| MDL Number | MFCD00008275 |
| SMILES | C[Si](C)(C)C[Si](C)(C)C |
| Synonym | bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl |
| IUPAC Name | trimethyl(trimethylsilylmethyl)silane |
| InChI Key | GYIODRUWWNNGPI-UHFFFAOYSA-N |
| Molecular Formula | C7H20Si2 |
(Pentafluoroethyl)trimethylsilane, 97%
CAS: 124898-13-1 Molecular Formula: C5H9F5Si Molecular Weight (g/mol): 192.204 MDL Number: MFCD04116436 InChI Key: MTPVUVINMAGMJL-UHFFFAOYSA-N Synonym: pentafluoroethyl trimethylsilane,trimethyl pentafluoroethyl silane,pentafluoroethyltrimethylsilane,trimethylpentafluoroethylsilane,trimethyl perfluoroethyl silane,trimethyl 1,1,2,2,2-pentafluoroethyl silane,silane, trimethyl pentafluoroethyl,silane,trimethyl 1,1,2,2,2-pentafluoroethyl,acmc-20aple,trimethylsilylpentafluoroethane PubChem CID: 2760820 IUPAC Name: trimethyl(1,1,2,2,2-pentafluoroethyl)silane SMILES: C[Si](C)(C)C(C(F)(F)F)(F)F
| PubChem CID | 2760820 |
|---|---|
| CAS | 124898-13-1 |
| Molecular Weight (g/mol) | 192.204 |
| MDL Number | MFCD04116436 |
| SMILES | C[Si](C)(C)C(C(F)(F)F)(F)F |
| Synonym | pentafluoroethyl trimethylsilane,trimethyl pentafluoroethyl silane,pentafluoroethyltrimethylsilane,trimethylpentafluoroethylsilane,trimethyl perfluoroethyl silane,trimethyl 1,1,2,2,2-pentafluoroethyl silane,silane, trimethyl pentafluoroethyl,silane,trimethyl 1,1,2,2,2-pentafluoroethyl,acmc-20aple,trimethylsilylpentafluoroethane |
| IUPAC Name | trimethyl(1,1,2,2,2-pentafluoroethyl)silane |
| InChI Key | MTPVUVINMAGMJL-UHFFFAOYSA-N |
| Molecular Formula | C5H9F5Si |
Dimethoxydimethylsilane, 97%
CAS: 1112-39-6 Molecular Formula: C4H12O2Si Molecular Weight (g/mol): 120.22 MDL Number: MFCD00025691 InChI Key: JJQZDUKDJDQPMQ-UHFFFAOYSA-N Synonym: dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane PubChem CID: 66187 IUPAC Name: dimethoxydimethylsilane SMILES: CO[Si](C)(C)OC
| PubChem CID | 66187 |
|---|---|
| CAS | 1112-39-6 |
| Molecular Weight (g/mol) | 120.22 |
| MDL Number | MFCD00025691 |
| SMILES | CO[Si](C)(C)OC |
| Synonym | dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane |
| IUPAC Name | dimethoxydimethylsilane |
| InChI Key | JJQZDUKDJDQPMQ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O2Si |